C16H14F4N2O3S — CID 90075291
N-(3,4-difluorophenyl)-2,6-difluoro-3-(propan-2-ylsulfamoyl)benzamide (PubChem CID 90075291) has the molecular formula C16H14F4N2O3S and a molecular weight of 390.36 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2,6-difluoro-3-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-(3,4-difluorophenyl)-2,6-difluoro-3-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 90075291 |
| Molecular Formula | C16H14F4N2O3S |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-(3,4-difluorophenyl)-2,6-difluoro-3-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(F)c(F)c2)c1F |
| InChI | InChI=1S/C16H14F4N2O3S/c1-8(2)22-26(24,25)13-6-5-11(18)14(15(13)20)16(23)21-9-3-4-10(17)12(19)7-9/h3-8,22H,1-2H3,(H,21,23) |
| InChIKey | XNJSFEBAYXWLPZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |