C17H22ClN3O2 — CID 90077064
4-(7-chloroquinolin-4-yl)oxy-N-[(propan-2-ylamino)methyl]butanamide (PubChem CID 90077064) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.83 g/mol. Its IUPAC name is 4-(7-chloroquinolin-4-yl)oxy-N-[(propan-2-ylamino)methyl]butanamide.
| Compound Name | 4-(7-chloroquinolin-4-yl)oxy-N-[(propan-2-ylamino)methyl]butanamide |
|---|---|
| PubChem CID | 90077064 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-(7-chloroquinolin-4-yl)oxy-N-[(propan-2-ylamino)methyl]butanamide |
| SMILES | CC(C)NCNC(=O)CCCOc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C17H22ClN3O2/c1-12(2)20-11-21-17(22)4-3-9-23-16-7-8-19-15-10-13(18)5-6-14(15)16/h5-8,10,12,20H,3-4,9,11H2,1-2H3,(H,21,22) |
| InChIKey | LVWZYBXMZIRHRX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|