C23H25N3O4 — CID 90116619
2-(methylamino)-4-oxo-2-[4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]butanoic acid (PubChem CID 90116619) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-(methylamino)-4-oxo-2-[4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]butanoic acid.
| Compound Name | 2-(methylamino)-4-oxo-2-[4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]butanoic acid |
|---|---|
| PubChem CID | 90116619 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-(methylamino)-4-oxo-2-[4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]butanoic acid |
| SMILES | CNC(CC=O)(C(=O)O)C1c2ccccc2N(C(=O)c2cccnc2)C2CCCC21 |
| InChI | InChI=1S/C23H25N3O4/c1-24-23(11-13-27,22(29)30)20-16-7-2-3-9-18(16)26(19-10-4-8-17(19)20)21(28)15-6-5-12-25-14-15/h2-3,5-7,9,12-14,17,19-20,24H,4,8,10-11H2,1H3,(H,29,30) |
| InChIKey | LVGRPHFKXKBXRA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|