C39H38O10 — CID 90121438
[4-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-2-methoxyphenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)naphthalene-1-carboxylate (PubChem CID 90121438) has the molecular formula C39H38O10 and a molecular weight of 666.72 g/mol. Its IUPAC name is [4-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-2-methoxyphenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)naphthalene-1-carboxylate.
| Compound Name | [4-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-2-methoxyphenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 90121438 |
| Molecular Formula | C39H38O10 |
| Molecular Weight | 666.72 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | [4-[4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-2-methoxyphenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)naphthalene-1-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(/C=C/C(=O)OCC)cc3OC)cc2)c2ccccc12 |
| InChI | InChI=1S/C39H38O10/c1-4-36(40)47-25-11-7-6-10-24-46-33-22-20-32(30-12-8-9-13-31(30)33)39(43)48-29-18-16-28(17-19-29)38(42)49-34-21-14-27(26-35(34)44-3)15-23-37(41)45-5-2/h4,8-9,12-23,26H,1,5-7,10-11,24-25H2,2-3H3/b23-15+ |
| InChIKey | KFGSYMBUGYNEFU-HZHRSRAPSA-N |
| XLogP | 7.53 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.72 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|