About 1H-indolo[3,2-c]acridine
1H-indolo[3,2-c]acridine (PubChem CID 90122341) has the molecular formula C19H12N2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 1H-indolo[3,2-c]acridine.
Molecular Properties
| Compound Name | 1H-indolo[3,2-c]acridine |
| PubChem CID | 90122341 |
| Molecular Formula | C19H12N2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1H-indolo[3,2-c]acridine |
| SMILES | C1=CCC2=Nc3c(ccc4cc5ccccc5nc34)C2=C1 |
| InChI | InChI=1S/C19H12N2/c1-3-7-16-12(5-1)11-13-9-10-15-14-6-2-4-8-17(14)21-19(15)18(13)20-16/h1-7,9-11H,8H2 |
| InChIKey | LKKWDROEURGWQY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-indolo[3,2-c]acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indolo[3,2-c]acridine?
The IUPAC name of 1H-indolo[3,2-c]acridine (CID 90122341) is 1H-indolo[3,2-c]acridine.
What is the SMILES notation for 1H-indolo[3,2-c]acridine?
The canonical SMILES for 1H-indolo[3,2-c]acridine is C1=CCC2=Nc3c(ccc4cc5ccccc5nc34)C2=C1.
What is the InChIKey of 1H-indolo[3,2-c]acridine?
The InChIKey is LKKWDROEURGWQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N2/c1-3-7-16-12(5-1)11-13-9-10-15-14-6-2-4-8-17(14)21-19(15)18(13)20-16/h1-7,9-11H,8H2.
What are the key properties of 1H-indolo[3,2-c]acridine?
1H-indolo[3,2-c]acridine has a molecular weight of 268.32 g/mol, XLogP of 4.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indolo[3,2-c]acridine is sourced from PubChem (CID 90122341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).