C21H30F2N4O — CID 90127937
[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1-propan-2-yl-3,4,5,7-tetrahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)oxan-3-yl]hydrazine (PubChem CID 90127937) has the molecular formula C21H30F2N4O and a molecular weight of 392.49 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1-propan-2-yl-3,4,5,7-tetrahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)oxan-3-yl]hydrazine.
| Compound Name | [(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1-propan-2-yl-3,4,5,7-tetrahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)oxan-3-yl]hydrazine |
|---|---|
| PubChem CID | 90127937 |
| Molecular Formula | C21H30F2N4O |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | [(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(1-propan-2-yl-3,4,5,7-tetrahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)oxan-3-yl]hydrazine |
| SMILES | CC(C)N1CCCC2=C1CN([C@H]1CO[C@H](c3cc(F)ccc3F)[C@@H](NN)C1)C2 |
| InChI | InChI=1S/C21H30F2N4O/c1-13(2)27-7-3-4-14-10-26(11-20(14)27)16-9-19(25-24)21(28-12-16)17-8-15(22)5-6-18(17)23/h5-6,8,13,16,19,21,25H,3-4,7,9-12,24H2,1-2H3/t16-,19+,21-/m1/s1 |
| InChIKey | XTUYQYUIIGPLTI-LKUPVBHCSA-N |
| XLogP | 2.70 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|