C37H52N2O4S — CID 90135707
[2-(2-benzylsulfanylethylamino)-2-oxoethyl] (5Z,11Z,14Z,17Z,20Z,23Z)-4-amino-7-oxohexacosa-5,11,14,17,20,23-hexaenoate (PubChem CID 90135707) has the molecular formula C37H52N2O4S and a molecular weight of 620.90 g/mol. Its IUPAC name is [2-(2-benzylsulfanylethylamino)-2-oxoethyl] (5Z,11Z,14Z,17Z,20Z,23Z)-4-amino-7-oxohexacosa-5,11,14,17,20,23-hexaenoate.
| Compound Name | [2-(2-benzylsulfanylethylamino)-2-oxoethyl] (5Z,11Z,14Z,17Z,20Z,23Z)-4-amino-7-oxohexacosa-5,11,14,17,20,23-hexaenoate |
|---|---|
| PubChem CID | 90135707 |
| Molecular Formula | C37H52N2O4S |
| Molecular Weight | 620.90 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | [2-(2-benzylsulfanylethylamino)-2-oxoethyl] (5Z,11Z,14Z,17Z,20Z,23Z)-4-amino-7-oxohexacosa-5,11,14,17,20,23-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)/C=C\C(N)CCC(=O)OCC(=O)NCCSCc1ccccc1 |
| InChI | InChI=1S/C37H52N2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-35(40)27-25-34(38)26-28-37(42)43-31-36(41)39-29-30-44-32-33-22-19-18-20-23-33/h3-4,6-7,9-10,12-13,15-16,18-20,22-23,25,27,34H,2,5,8,11,14,17,21,24,26,28-32,38H2,1H3,(H,39,41)/b4-3-,7-6-,10-9-,13-12-,16-15-,27-25- |
| InChIKey | NOSJKMRUTIYRAA-ACISIKNQSA-N |
| XLogP | 7.73 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.90 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|