C28H29ClF3N7O2 — CID 90142492
[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]phenyl]-(2,7-diazaspiro[4.4]nonan-2-yl)methanone (PubChem CID 90142492) has the molecular formula C28H29ClF3N7O2 and a molecular weight of 588.03 g/mol. Its IUPAC name is [4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]phenyl]-(2,7-diazaspiro[4.4]nonan-2-yl)methanone.
| Compound Name | [4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]phenyl]-(2,7-diazaspiro[4.4]nonan-2-yl)methanone |
|---|---|
| PubChem CID | 90142492 |
| Molecular Formula | C28H29ClF3N7O2 |
| Molecular Weight | 588.03 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | [4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]phenyl]-(2,7-diazaspiro[4.4]nonan-2-yl)methanone |
| SMILES | O=C(c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1)N1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C28H29ClF3N7O2/c29-20-5-3-19(4-6-20)27(9-10-27)38-24-35-23(36-25(37-24)41-17-28(30,31)32)34-21-7-1-18(2-8-21)22(40)39-14-12-26(16-39)11-13-33-15-26/h1-8,33H,9-17H2,(H2,34,35,36,37,38) |
| InChIKey | RIYCCXXOMPFGRX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.03 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |