C15H23NO2 — CID 90144768
N-butyl-N-propan-2-yl-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 90144768) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N-butyl-N-propan-2-yl-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-butyl-N-propan-2-yl-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 90144768 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-butyl-N-propan-2-yl-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CCCCN(c1ccc2c(c1)OCCO2)C(C)C |
| InChI | InChI=1S/C15H23NO2/c1-4-5-8-16(12(2)3)13-6-7-14-15(11-13)18-10-9-17-14/h6-7,11-12H,4-5,8-10H2,1-3H3 |
| InChIKey | IGKPNQRMZZCYMF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|