C23H20N6O4S — CID 90150620
(7Z)-2-(4-morpholin-4-ylanilino)-7-[(4-nitrophenyl)methylidene]-5H-pyrimido[4,5-b][1,4]thiazin-6-one (PubChem CID 90150620) has the molecular formula C23H20N6O4S and a molecular weight of 476.52 g/mol. Its IUPAC name is (7Z)-2-(4-morpholin-4-ylanilino)-7-[(4-nitrophenyl)methylidene]-5H-pyrimido[4,5-b][1,4]thiazin-6-one.
| Compound Name | (7Z)-2-(4-morpholin-4-ylanilino)-7-[(4-nitrophenyl)methylidene]-5H-pyrimido[4,5-b][1,4]thiazin-6-one |
|---|---|
| PubChem CID | 90150620 |
| Molecular Formula | C23H20N6O4S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (7Z)-2-(4-morpholin-4-ylanilino)-7-[(4-nitrophenyl)methylidene]-5H-pyrimido[4,5-b][1,4]thiazin-6-one |
| SMILES | O=C1Nc2cnc(Nc3ccc(N4CCOCC4)cc3)nc2S/C1=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H20N6O4S/c30-21-20(13-15-1-5-18(6-2-15)29(31)32)34-22-19(26-21)14-24-23(27-22)25-16-3-7-17(8-4-16)28-9-11-33-12-10-28/h1-8,13-14H,9-12H2,(H,26,30)(H,24,25,27)/b20-13- |
| InChIKey | HJZLQCAWOJQELA-MOSHPQCFSA-N |
| XLogP | 4.05 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|