C15H22F5NO3Si — CID 90171452
N-[4-[dimethoxy(propan-2-yloxy)silyl]butyl]-2,3,4,5,6-pentafluoroaniline (PubChem CID 90171452) has the molecular formula C15H22F5NO3Si and a molecular weight of 387.42 g/mol. Its IUPAC name is N-[4-[dimethoxy(propan-2-yloxy)silyl]butyl]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[4-[dimethoxy(propan-2-yloxy)silyl]butyl]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 90171452 |
| Molecular Formula | C15H22F5NO3Si |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[4-[dimethoxy(propan-2-yloxy)silyl]butyl]-2,3,4,5,6-pentafluoroaniline |
| SMILES | CO[Si](CCCCNc1c(F)c(F)c(F)c(F)c1F)(OC)OC(C)C |
| InChI | InChI=1S/C15H22F5NO3Si/c1-9(2)24-25(22-3,23-4)8-6-5-7-21-15-13(19)11(17)10(16)12(18)14(15)20/h9,21H,5-8H2,1-4H3 |
| InChIKey | ZYTFJLZBAKXEAQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|