C18H24N2O7S — CID 90180510
methyl 5-acetylsulfanyl-2-methyl-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoate (PubChem CID 90180510) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is methyl 5-acetylsulfanyl-2-methyl-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoate.
| Compound Name | methyl 5-acetylsulfanyl-2-methyl-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 90180510 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | methyl 5-acetylsulfanyl-2-methyl-6-[(4-nitrophenyl)methoxycarbonylamino]hexanoate |
| SMILES | COC(=O)C(C)CCC(CNC(=O)OCc1ccc([N+](=O)[O-])cc1)SC(C)=O |
| InChI | InChI=1S/C18H24N2O7S/c1-12(17(22)26-3)4-9-16(28-13(2)21)10-19-18(23)27-11-14-5-7-15(8-6-14)20(24)25/h5-8,12,16H,4,9-11H2,1-3H3,(H,19,23) |
| InChIKey | AKPNFADCUOOOTB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|