C10H8ClN3 — CID 90191878
8-chloro-4,5-dihydro-1H-pyrazolo[4,5-h]quinoline (PubChem CID 90191878) has the molecular formula C10H8ClN3 and a molecular weight of 205.65 g/mol. Its IUPAC name is 8-chloro-4,5-dihydro-1H-pyrazolo[4,5-h]quinoline.
| Compound Name | 8-chloro-4,5-dihydro-1H-pyrazolo[4,5-h]quinoline |
|---|---|
| PubChem CID | 90191878 |
| Molecular Formula | C10H8ClN3 |
| Molecular Weight | 205.65 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 8-chloro-4,5-dihydro-1H-pyrazolo[4,5-h]quinoline |
| SMILES | Clc1ccc2c(n1)-c1[nH]ncc1CC2 |
| InChI | InChI=1S/C10H8ClN3/c11-8-4-3-6-1-2-7-5-12-14-10(7)9(6)13-8/h3-5H,1-2H2,(H,12,14) |
| InChIKey | QHSHQJLKUJMISX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|