C23H30BrFNO4PS — CID 90218512
3-[[3-bromo-4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 90218512) has the molecular formula C23H30BrFNO4PS and a molecular weight of 546.44 g/mol. Its IUPAC name is 3-[[3-bromo-4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[3-bromo-4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218512 |
| Molecular Formula | C23H30BrFNO4PS |
| Molecular Weight | 546.44 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | 3-[[3-bromo-4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(SCCCCC2(c3ccccc3F)COC2)c(Br)c1 |
| InChI | InChI=1S/C23H30BrFNO4PS/c24-20-14-18(15-26-11-5-12-31(27,28)29)8-9-22(20)32-13-4-3-10-23(16-30-17-23)19-6-1-2-7-21(19)25/h1-2,6-9,14,26H,3-5,10-13,15-17H2,(H2,27,28,29) |
| InChIKey | MLJAAZSRYISNFE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|