C15H30O2P2 — CID 90224828
[(2E,6E)-8-methoxy-3,7-dimethyldodeca-2,6-dienoxy]-phosphanylphosphane (PubChem CID 90224828) has the molecular formula C15H30O2P2 and a molecular weight of 304.35 g/mol. Its IUPAC name is [(2E,6E)-8-methoxy-3,7-dimethyldodeca-2,6-dienoxy]-phosphanylphosphane.
| Compound Name | [(2E,6E)-8-methoxy-3,7-dimethyldodeca-2,6-dienoxy]-phosphanylphosphane |
|---|---|
| PubChem CID | 90224828 |
| Molecular Formula | C15H30O2P2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [(2E,6E)-8-methoxy-3,7-dimethyldodeca-2,6-dienoxy]-phosphanylphosphane |
| SMILES | CCCCC(OC)/C(C)=C/CC/C(C)=C/COPP |
| InChI | InChI=1S/C15H30O2P2/c1-5-6-10-15(16-4)14(3)9-7-8-13(2)11-12-17-19-18/h9,11,15,19H,5-8,10,12,18H2,1-4H3/b13-11+,14-9+ |
| InChIKey | WPYSCUSAQXJNIS-AOAVBJDHSA-N |
| XLogP | 5.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|