C22H37NOP2 — CID 59967276
N-[(2E,6E)-8-(diphosphanyloxy)-2,6-dimethylocta-2,6-dienyl]-N,2,3,4,5,6-hexamethylaniline (PubChem CID 59967276) has the molecular formula C22H37NOP2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[(2E,6E)-8-(diphosphanyloxy)-2,6-dimethylocta-2,6-dienyl]-N,2,3,4,5,6-hexamethylaniline.
| Compound Name | N-[(2E,6E)-8-(diphosphanyloxy)-2,6-dimethylocta-2,6-dienyl]-N,2,3,4,5,6-hexamethylaniline |
|---|---|
| PubChem CID | 59967276 |
| Molecular Formula | C22H37NOP2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N-[(2E,6E)-8-(diphosphanyloxy)-2,6-dimethylocta-2,6-dienyl]-N,2,3,4,5,6-hexamethylaniline |
| SMILES | C/C(=C\COPP)CC/C=C(\C)CN(C)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C22H37NOP2/c1-15(12-13-24-26-25)10-9-11-16(2)14-23(8)22-20(6)18(4)17(3)19(5)21(22)7/h11-12,26H,9-10,13-14,25H2,1-8H3/b15-12+,16-11+ |
| InChIKey | YWLYVOFKJXTIBN-KSELWQEASA-N |
| XLogP | 6.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|