C15H28OP2 — CID 90224829
phosphanyl-[(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phosphane (PubChem CID 90224829) has the molecular formula C15H28OP2 and a molecular weight of 286.34 g/mol. Its IUPAC name is phosphanyl-[(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phosphane.
| Compound Name | phosphanyl-[(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phosphane |
|---|---|
| PubChem CID | 90224829 |
| Molecular Formula | C15H28OP2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | phosphanyl-[(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phosphane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C\COPP |
| InChI | InChI=1S/C15H28OP2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16-18-17/h7,9,11,18H,5-6,8,10,12,17H2,1-4H3/b14-9+,15-11- |
| InChIKey | UGRWSSVADJILCW-PVMFERMNSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|