C18H32O2 — CID 71405750
3,7-dimethylocta-2,6-dienyl 2-ethylhexanoate (PubChem CID 71405750) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienyl 2-ethylhexanoate.
| Compound Name | 3,7-dimethylocta-2,6-dienyl 2-ethylhexanoate |
|---|---|
| PubChem CID | 71405750 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienyl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C18H32O2/c1-6-8-12-17(7-2)18(19)20-14-13-16(5)11-9-10-15(3)4/h10,13,17H,6-9,11-12,14H2,1-5H3 |
| InChIKey | IRGQKVKJPAFLOT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|