C27H33N3O3 — CID 90248950
benzyl N-[4-[4-[(3S)-4-amino-3-methyl-4-oxobutyl]naphthalen-1-yl]butylamino]carbamate (PubChem CID 90248950) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is benzyl N-[4-[4-[(3S)-4-amino-3-methyl-4-oxobutyl]naphthalen-1-yl]butylamino]carbamate.
| Compound Name | benzyl N-[4-[4-[(3S)-4-amino-3-methyl-4-oxobutyl]naphthalen-1-yl]butylamino]carbamate |
|---|---|
| PubChem CID | 90248950 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | benzyl N-[4-[4-[(3S)-4-amino-3-methyl-4-oxobutyl]naphthalen-1-yl]butylamino]carbamate |
| SMILES | C[C@@H](CCc1ccc(CCCCNNC(=O)OCc2ccccc2)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C27H33N3O3/c1-20(26(28)31)14-15-23-17-16-22(24-12-5-6-13-25(23)24)11-7-8-18-29-30-27(32)33-19-21-9-3-2-4-10-21/h2-6,9-10,12-13,16-17,20,29H,7-8,11,14-15,18-19H2,1H3,(H2,28,31)(H,30,32)/t20-/m0/s1 |
| InChIKey | YRRQEVKNCMOKFY-FQEVSTJZSA-N |
| XLogP | 4.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|