C18H33NO6 — CID 90258112
2-[(3-hydroxy-3-methyldodecanoyl)amino]pentanedioic acid (PubChem CID 90258112) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-[(3-hydroxy-3-methyldodecanoyl)amino]pentanedioic acid.
| Compound Name | 2-[(3-hydroxy-3-methyldodecanoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 90258112 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 2-[(3-hydroxy-3-methyldodecanoyl)amino]pentanedioic acid |
| SMILES | CCCCCCCCCC(C)(O)CC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H33NO6/c1-3-4-5-6-7-8-9-12-18(2,25)13-15(20)19-14(17(23)24)10-11-16(21)22/h14,25H,3-13H2,1-2H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | ZEBXHCQHUMKELP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|