C15H27NO6 — CID 90258594
2-[(3-hydroxy-3-methylnonanoyl)amino]pentanedioic acid (PubChem CID 90258594) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-[(3-hydroxy-3-methylnonanoyl)amino]pentanedioic acid.
| Compound Name | 2-[(3-hydroxy-3-methylnonanoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 90258594 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 2-[(3-hydroxy-3-methylnonanoyl)amino]pentanedioic acid |
| SMILES | CCCCCCC(C)(O)CC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H27NO6/c1-3-4-5-6-9-15(2,22)10-12(17)16-11(14(20)21)7-8-13(18)19/h11,22H,3-10H2,1-2H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | XMZYTEVWEADVDT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|