C17H23FN2O2S — CID 90264803
(E)-3-(2-fluorophenyl)-2-methyl-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]prop-2-enamide (PubChem CID 90264803) has the molecular formula C17H23FN2O2S and a molecular weight of 338.45 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-2-methyl-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-2-methyl-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 90264803 |
| Molecular Formula | C17H23FN2O2S |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-2-methyl-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]prop-2-enamide |
| SMILES | C/C(=C\c1ccccc1F)C(=O)NCCCN1CCS(=O)CC1 |
| InChI | InChI=1S/C17H23FN2O2S/c1-14(13-15-5-2-3-6-16(15)18)17(21)19-7-4-8-20-9-11-23(22)12-10-20/h2-3,5-6,13H,4,7-12H2,1H3,(H,19,21)/b14-13+ |
| InChIKey | QLYIVQQUZCGCFU-BUHFOSPRSA-N |
| XLogP | 1.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|