C21H29BrN8O3S — CID 90271919
tert-butyl 4-[3-bromo-4-[(5-carbamoyl-6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 90271919) has the molecular formula C21H29BrN8O3S and a molecular weight of 553.49 g/mol. Its IUPAC name is tert-butyl 4-[3-bromo-4-[(5-carbamoyl-6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-bromo-4-[(5-carbamoyl-6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90271919 |
| Molecular Formula | C21H29BrN8O3S |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | tert-butyl 4-[3-bromo-4-[(5-carbamoyl-6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CSc1nc(NN)c(C(N)=O)c(Nc2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2Br)n1 |
| InChI | InChI=1S/C21H29BrN8O3S/c1-21(2,3)33-20(32)30-9-7-29(8-10-30)12-5-6-14(13(22)11-12)25-17-15(16(23)31)18(28-24)27-19(26-17)34-4/h5-6,11H,7-10,24H2,1-4H3,(H2,23,31)(H2,25,26,27,28) |
| InChIKey | OIJORGYWIMCYEP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|