C28H31BN2O3 — CID 90274526
[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)phenyl]methanone (PubChem CID 90274526) has the molecular formula C28H31BN2O3 and a molecular weight of 454.38 g/mol. Its IUPAC name is [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)phenyl]methanone.
| Compound Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)phenyl]methanone |
|---|---|
| PubChem CID | 90274526 |
| Molecular Formula | C28H31BN2O3 |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[3-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)phenyl]methanone |
| SMILES | CC1(C)OB(O)c2cc(-c3cccc(C(=O)N4CCC(c5cccc(CN)c5)CC4)c3)ccc21 |
| InChI | InChI=1S/C28H31BN2O3/c1-28(2)25-10-9-23(17-26(25)29(33)34-28)22-7-4-8-24(16-22)27(32)31-13-11-20(12-14-31)21-6-3-5-19(15-21)18-30/h3-10,15-17,20,33H,11-14,18,30H2,1-2H3 |
| InChIKey | PIXCJOOQUDIZBT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|