C24H23N3O3 — CID 90300807
2-hydroxy-N-[5-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)pentyl]benzamide (PubChem CID 90300807) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-hydroxy-N-[5-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)pentyl]benzamide.
| Compound Name | 2-hydroxy-N-[5-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)pentyl]benzamide |
|---|---|
| PubChem CID | 90300807 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-hydroxy-N-[5-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)pentyl]benzamide |
| SMILES | O=C(NCCCCCc1ccc2oc(-c3cccnc3)nc2c1)c1ccccc1O |
| InChI | InChI=1S/C24H23N3O3/c28-21-10-4-3-9-19(21)23(29)26-14-5-1-2-7-17-11-12-22-20(15-17)27-24(30-22)18-8-6-13-25-16-18/h3-4,6,8-13,15-16,28H,1-2,5,7,14H2,(H,26,29) |
| InChIKey | DNOHBUMCPCXOOW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|