C26H38N4O8 — CID 90303906
1-O-benzyl 4-O-ethyl 2-carbamoylpiperidine-1,4-dicarboxylate;ethyl 2-carbamoylpiperidine-4-carboxylate (PubChem CID 90303906) has the molecular formula C26H38N4O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is 1-O-benzyl 4-O-ethyl 2-carbamoylpiperidine-1,4-dicarboxylate;ethyl 2-carbamoylpiperidine-4-carboxylate.
| Compound Name | 1-O-benzyl 4-O-ethyl 2-carbamoylpiperidine-1,4-dicarboxylate;ethyl 2-carbamoylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 90303906 |
| Molecular Formula | C26H38N4O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 1-O-benzyl 4-O-ethyl 2-carbamoylpiperidine-1,4-dicarboxylate;ethyl 2-carbamoylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)OCc2ccccc2)C(C(N)=O)C1.CCOC(=O)C1CCNC(C(N)=O)C1 |
| InChI | InChI=1S/C17H22N2O5.C9H16N2O3/c1-2-23-16(21)13-8-9-19(14(10-13)15(18)20)17(22)24-11-12-6-4-3-5-7-12;1-2-14-9(13)6-3-4-11-7(5-6)8(10)12/h3-7,13-14H,2,8-11H2,1H3,(H2,18,20);6-7,11H,2-5H2,1H3,(H2,10,12) |
| InChIKey | XIKGPRXCOPHJHD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 180.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|