C16H21NO3 — CID 90304880
2-amino-3-[4-(3-methyl-4-oxohex-1-en-2-yl)phenyl]propanoic acid (PubChem CID 90304880) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-amino-3-[4-(3-methyl-4-oxohex-1-en-2-yl)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-(3-methyl-4-oxohex-1-en-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 90304880 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-amino-3-[4-(3-methyl-4-oxohex-1-en-2-yl)phenyl]propanoic acid |
| SMILES | C=C(c1ccc(CC(N)C(=O)O)cc1)C(C)C(=O)CC |
| InChI | InChI=1S/C16H21NO3/c1-4-15(18)11(3)10(2)13-7-5-12(6-8-13)9-14(17)16(19)20/h5-8,11,14H,2,4,9,17H2,1,3H3,(H,19,20) |
| InChIKey | KSPJEQIQONDCTG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |