C27H33NO2 — CID 90334014
2-(2-anthracen-9-ylethyl)-4,4-dimethyl-6-(prop-2-enylamino)hexanoic acid (PubChem CID 90334014) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 2-(2-anthracen-9-ylethyl)-4,4-dimethyl-6-(prop-2-enylamino)hexanoic acid.
| Compound Name | 2-(2-anthracen-9-ylethyl)-4,4-dimethyl-6-(prop-2-enylamino)hexanoic acid |
|---|---|
| PubChem CID | 90334014 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-(2-anthracen-9-ylethyl)-4,4-dimethyl-6-(prop-2-enylamino)hexanoic acid |
| SMILES | C=CCNCCC(C)(C)CC(CCc1c2ccccc2cc2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H33NO2/c1-4-16-28-17-15-27(2,3)19-22(26(29)30)13-14-25-23-11-7-5-9-20(23)18-21-10-6-8-12-24(21)25/h4-12,18,22,28H,1,13-17,19H2,2-3H3,(H,29,30) |
| InChIKey | OFVRIUSJQCDYAS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|