C27H33NO2 — CID 90334015
2-anthracen-9-ylethyl 4,4-dimethyl-6-(prop-2-enylamino)hexanoate (PubChem CID 90334015) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 2-anthracen-9-ylethyl 4,4-dimethyl-6-(prop-2-enylamino)hexanoate.
| Compound Name | 2-anthracen-9-ylethyl 4,4-dimethyl-6-(prop-2-enylamino)hexanoate |
|---|---|
| PubChem CID | 90334015 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-anthracen-9-ylethyl 4,4-dimethyl-6-(prop-2-enylamino)hexanoate |
| SMILES | C=CCNCCC(C)(C)CCC(=O)OCCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C27H33NO2/c1-4-17-28-18-16-27(2,3)15-13-26(29)30-19-14-25-23-11-7-5-9-21(23)20-22-10-6-8-12-24(22)25/h4-12,20,28H,1,13-19H2,2-3H3 |
| InChIKey | NMXDHAUYDQUPFF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|