C19H20ClFNO6P — CID 90344295
(3R)-4-[2-(5-chloro-2-fluorophenyl)phenyl]-3-(3-phosphonopropanoylamino)butanoic acid (PubChem CID 90344295) has the molecular formula C19H20ClFNO6P and a molecular weight of 443.80 g/mol. Its IUPAC name is (3R)-4-[2-(5-chloro-2-fluorophenyl)phenyl]-3-(3-phosphonopropanoylamino)butanoic acid.
| Compound Name | (3R)-4-[2-(5-chloro-2-fluorophenyl)phenyl]-3-(3-phosphonopropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 90344295 |
| Molecular Formula | C19H20ClFNO6P |
| Molecular Weight | 443.80 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | (3R)-4-[2-(5-chloro-2-fluorophenyl)phenyl]-3-(3-phosphonopropanoylamino)butanoic acid |
| SMILES | O=C(O)C[C@@H](Cc1ccccc1-c1cc(Cl)ccc1F)NC(=O)CCP(=O)(O)O |
| InChI | InChI=1S/C19H20ClFNO6P/c20-13-5-6-17(21)16(10-13)15-4-2-1-3-12(15)9-14(11-19(24)25)22-18(23)7-8-29(26,27)28/h1-6,10,14H,7-9,11H2,(H,22,23)(H,24,25)(H2,26,27,28)/t14-/m1/s1 |
| InChIKey | GIGZXEDBTVMBCJ-CQSZACIVSA-N |
| XLogP | 3.22 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.80 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|