C17H36O7Si — CID 90351093
2-[[butyl(diethoxy)silyl]oxymethyl]-6-propan-2-yloxane-3,4,5-triol (PubChem CID 90351093) has the molecular formula C17H36O7Si and a molecular weight of 380.55 g/mol. Its IUPAC name is 2-[[butyl(diethoxy)silyl]oxymethyl]-6-propan-2-yloxane-3,4,5-triol.
| Compound Name | 2-[[butyl(diethoxy)silyl]oxymethyl]-6-propan-2-yloxane-3,4,5-triol |
|---|---|
| PubChem CID | 90351093 |
| Molecular Formula | C17H36O7Si |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-[[butyl(diethoxy)silyl]oxymethyl]-6-propan-2-yloxane-3,4,5-triol |
| SMILES | CCCC[Si](OCC)(OCC)OCC1OC(C(C)C)C(O)C(O)C1O |
| InChI | InChI=1S/C17H36O7Si/c1-6-9-10-25(21-7-2,22-8-3)23-11-13-14(18)15(19)16(20)17(24-13)12(4)5/h12-20H,6-11H2,1-5H3 |
| InChIKey | TYOCQMUMHZZYMR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|