C70H96B2N4O23P — CID 90352480
CID 90352480 (PubChem CID 90352480) has the molecular formula C70H96B2N4O23P and a molecular weight of 1414.14 g/mol.
| Compound Name | CID 90352480 |
|---|---|
| PubChem CID | 90352480 |
| Molecular Formula | C70H96B2N4O23P |
| Molecular Weight | 1414.14 g/mol |
| Exact Mass | 1413.64 |
| IUPAC Name | — |
| SMILES | CC[C@H](C)C1O[C@H](O[C@H]2C([C@H]3COC(C)(C)O3)O[C@@](Oc3ccc(CCCN(Cc4ccccc4)C(=O)OCc4ccccc4)cc3)(C(=O)OC)C[C@H]2C)C(OC(C)=O)[C@@H](O[C@H]2O[C@@H]([C@@H](C)CC)CC(C)C2O[C@H]2OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)[C@H]2N=[N+]=[N-])[C@@H]1P[B]B=O |
| InChI | InChI=1S/C70H96B2N4O23P/c1-14-39(3)51-33-41(5)57(95-64-54(74-75-73)60(89-45(9)79)58(88-44(8)78)52(92-64)37-85-43(7)77)65(91-51)96-61-62(90-46(10)80)66(94-56(40(4)15-2)63(61)100-72-71-83)93-55-42(6)34-70(67(81)84-13,99-59(55)53-38-87-69(11,12)98-53)97-50-30-28-47(29-31-50)27-22-32-76(35-48-23-18-16-19-24-48)68(82)86-36-49-25-20-17-21-26-49/h16-21,23-26,28-31,39-42,51-66,100H,14-15,22,27,32-38H2,1-13H3/t39-,40-,41?,42+,51+,52?,53+,54+,55+,56?,57?,58+,59?,60?,61+,62?,63+,64+,65+,66-,70+/m0/s1 |
| InChIKey | HCFJGWAYUKKHHK-JCSDBKBUSA-N |
| XLogP | 9.40 |
| TPSA | 319.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 100 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1414.14 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|