C46H70ArB4F3N7O21P2S — CID 158520033
CID 158520033 (PubChem CID 158520033) has the molecular formula C46H70ArB4F3N7O21P2S and a molecular weight of 1291.30 g/mol.
| Compound Name | CID 158520033 |
|---|---|
| PubChem CID | 158520033 |
| Molecular Formula | C46H70ArB4F3N7O21P2S |
| Molecular Weight | 1291.30 g/mol |
| Exact Mass | 1291.38 |
| IUPAC Name | — |
| SMILES | CC[C@H](C)C1OC(S)C(O[C@H]2OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C2N=[N+]=[N-])[C@@H](C)[C@@H]1P[B]B=O.[Ar].[H]/N=C(/OC1OC([C@@H](C)CC)[C@@H](P[B]B=O)[C@H](C)C1O[C@H]1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C1N=[N+]=[N-])C(F)(F)F |
| InChI | InChI=1S/C24H35B2F3N4O11P.C22H35B2N3O10PS.Ar/c1-7-9(2)16-20(45-26-25-37)10(3)17(22(42-16)44-23(30)24(27,28)29)43-21-15(32-33-31)19(40-13(6)36)18(39-12(5)35)14(41-21)8-38-11(4)34;1-7-9(2)16-20(38-24-23-31)10(3)17(22(39)37-16)36-21-15(26-27-25)19(34-13(6)30)18(33-12(5)29)14(35-21)8-32-11(4)28;/h9-10,14-22,30,45H,7-8H2,1-6H3;9-10,14-22,38-39H,7-8H2,1-6H3;/b30-23+;;/t2*9-,10+,14?,15?,16?,17?,18+,19?,20-,21+,22?;/m00./s1 |
| InChIKey | ZJTXEOOIVBYQSF-MQKDXWNCSA-N |
| XLogP | 4.97 |
| TPSA | 377.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 25 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1291.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 25 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|