C45H66B2N2O13P — CID 90352482
CID 90352482 (PubChem CID 90352482) has the molecular formula C45H66B2N2O13P and a molecular weight of 895.62 g/mol.
| Compound Name | CID 90352482 |
|---|---|
| PubChem CID | 90352482 |
| Molecular Formula | C45H66B2N2O13P |
| Molecular Weight | 895.62 g/mol |
| Exact Mass | 895.45 |
| IUPAC Name | — |
| SMILES | CC[C@H](C)C1O[C@H](O[C@H]2C([C@H]3COC(C)(C)O3)O[C@@](OCCN(C)CCN(Cc3ccccc3)C(=O)OCc3ccccc3)(C(=O)OC)C[C@H]2C)C(OC(C)=O)[C@@H](C)[C@@H]1P[B]B=O |
| InChI | InChI=1S/C45H66B2N2O13P/c1-10-29(2)37-40(63-47-46-53)31(4)38(58-32(5)50)41(60-37)59-36-30(3)25-45(42(51)54-9,62-39(36)35-28-57-44(6,7)61-35)56-24-23-48(8)21-22-49(26-33-17-13-11-14-18-33)43(52)55-27-34-19-15-12-16-20-34/h11-20,29-31,35-41,63H,10,21-28H2,1-9H3/t29-,30+,31+,35+,36+,37?,38?,39?,40-,41-,45+/m0/s1 |
| InChIKey | KUKHREICPMNHCN-XDFIXEMJSA-N |
| XLogP | 5.57 |
| TPSA | 157.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|