C66H107B2NO25P — CID 90352433
CID 90352433 (PubChem CID 90352433) has the molecular formula C66H107B2NO25P and a molecular weight of 1367.16 g/mol.
| Compound Name | CID 90352433 |
|---|---|
| PubChem CID | 90352433 |
| Molecular Formula | C66H107B2NO25P |
| Molecular Weight | 1367.16 g/mol |
| Exact Mass | 1366.71 |
| IUPAC Name | — |
| SMILES | CC[C@H](C)C1O[C@H](O[C@H]2C([C@H]3COC(C)(C)O3)O[C@@](OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN(Cc3ccccc3)C(=O)OCc3ccccc3)(C(=O)OC)C[C@H]2C)C(OC(C)=O)[C@@H](C)[C@@H]1P[B]B=O |
| InChI | InChI=1S/C66H107B2NO25P/c1-9-50(2)58-61(95-68-67-73)52(4)59(90-53(5)70)62(92-58)91-57-51(3)46-66(63(71)74-8,94-60(57)56-49-89-65(6,7)93-56)88-45-44-86-43-42-85-41-40-84-39-38-83-37-36-82-35-34-81-33-32-80-31-30-79-29-28-78-27-26-77-25-24-76-23-22-75-21-20-69(47-54-16-12-10-13-17-54)64(72)87-48-55-18-14-11-15-19-55/h10-19,50-52,56-62,95H,9,20-49H2,1-8H3/t50-,51+,52+,56+,57+,58?,59?,60?,61-,62-,66+/m0/s1 |
| InChIKey | CEEQNNRQFXLUIL-VTHUVLSISA-N |
| XLogP | 5.84 |
| TPSA | 265.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 25 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 95 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1367.16 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 25 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|