C49H72B2N2O13P — CID 90352450
CID 90352450 (PubChem CID 90352450) has the molecular formula C49H72B2N2O13P and a molecular weight of 949.71 g/mol.
| Compound Name | CID 90352450 |
|---|---|
| PubChem CID | 90352450 |
| Molecular Formula | C49H72B2N2O13P |
| Molecular Weight | 949.71 g/mol |
| Exact Mass | 949.50 |
| IUPAC Name | — |
| SMILES | CC[C@H](C)C1O[C@H](O[C@H]2C([C@H]3COC(C)(C)O3)O[C@@](OCCCC3CCCC(CN(Cc4ccccc4)C(=O)OCc4ccccc4)N3)(C(=O)OC)C[C@H]2C)C(OC(C)=O)[C@@H](C)[C@@H]1P[B]B=O |
| InChI | InChI=1S/C49H72B2N2O13P/c1-9-31(2)41-44(67-51-50-57)33(4)42(62-34(5)54)45(64-41)63-40-32(3)26-49(46(55)58-8,66-43(40)39-30-61-48(6,7)65-39)60-25-17-24-37-22-16-23-38(52-37)28-53(27-35-18-12-10-13-19-35)47(56)59-29-36-20-14-11-15-21-36/h10-15,18-21,31-33,37-45,52,67H,9,16-17,22-30H2,1-8H3/t31-,32+,33+,37?,38?,39+,40+,41?,42?,43?,44-,45-,49+/m0/s1 |
| InChIKey | BNTJACNCRVLNPR-QFNCQMJKSA-N |
| XLogP | 6.93 |
| TPSA | 166.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.71 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|