C16H25NO10S — CID 90360473
methyl 2-(2,3,5-triacetyloxy-1,4-dihydroxypentyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 90360473) has the molecular formula C16H25NO10S and a molecular weight of 423.44 g/mol. Its IUPAC name is methyl 2-(2,3,5-triacetyloxy-1,4-dihydroxypentyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 2-(2,3,5-triacetyloxy-1,4-dihydroxypentyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 90360473 |
| Molecular Formula | C16H25NO10S |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | methyl 2-(2,3,5-triacetyloxy-1,4-dihydroxypentyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)C1CSC(C(O)C(OC(C)=O)C(OC(C)=O)C(O)COC(C)=O)N1 |
| InChI | InChI=1S/C16H25NO10S/c1-7(18)25-5-11(21)13(26-8(2)19)14(27-9(3)20)12(22)15-17-10(6-28-15)16(23)24-4/h10-15,17,21-22H,5-6H2,1-4H3 |
| InChIKey | LPCQGBGBVWGEMI-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 157.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|