C28H30N2O12 — CID 90373596
1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 6-[4-(7-oxofuro[3,2-g]chromen-9-yl)oxybutanoylamino]hexanoate (PubChem CID 90373596) has the molecular formula C28H30N2O12 and a molecular weight of 586.55 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 6-[4-(7-oxofuro[3,2-g]chromen-9-yl)oxybutanoylamino]hexanoate.
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 6-[4-(7-oxofuro[3,2-g]chromen-9-yl)oxybutanoylamino]hexanoate |
|---|---|
| PubChem CID | 90373596 |
| Molecular Formula | C28H30N2O12 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethyl 6-[4-(7-oxofuro[3,2-g]chromen-9-yl)oxybutanoylamino]hexanoate |
| SMILES | CC(OC(=O)CCCCCNC(=O)CCCOc1c2occc2cc2ccc(=O)oc12)OC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C28H30N2O12/c1-17(40-28(36)42-30-21(32)9-10-22(30)33)39-23(34)7-3-2-4-13-29-20(31)6-5-14-37-27-25-19(12-15-38-25)16-18-8-11-24(35)41-26(18)27/h8,11-12,15-17H,2-7,9-10,13-14H2,1H3,(H,29,31) |
| InChIKey | JFLWXQMMKIPBAY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 180.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|