C12H22N2O5 — CID 90390449
(2,2-dimethylpyrrolidin-1-yl) 2,2-dimethyl-4-nitrooxybutanoate (PubChem CID 90390449) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2,2-dimethylpyrrolidin-1-yl) 2,2-dimethyl-4-nitrooxybutanoate.
| Compound Name | (2,2-dimethylpyrrolidin-1-yl) 2,2-dimethyl-4-nitrooxybutanoate |
|---|---|
| PubChem CID | 90390449 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (2,2-dimethylpyrrolidin-1-yl) 2,2-dimethyl-4-nitrooxybutanoate |
| SMILES | CC(C)(CCO[N+](=O)[O-])C(=O)ON1CCCC1(C)C |
| InChI | InChI=1S/C12H22N2O5/c1-11(2,7-9-18-14(16)17)10(15)19-13-8-5-6-12(13,3)4/h5-9H2,1-4H3 |
| InChIKey | PYAPMYVWXDXMPN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|