C9H11BN3O2 — CID 90408585
CID 90408585 (PubChem CID 90408585) has the molecular formula C9H11BN3O2 and a molecular weight of 204.02 g/mol.
| Compound Name | CID 90408585 |
|---|---|
| PubChem CID | 90408585 |
| Molecular Formula | C9H11BN3O2 |
| Molecular Weight | 204.02 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | — |
| SMILES | NNC(=O)c1ccc2c(c1)OCCN[B]2 |
| InChI | InChI=1S/C9H11BN3O2/c11-13-9(14)6-1-2-7-8(5-6)15-4-3-12-10-7/h1-2,5,12H,3-4,11H2,(H,13,14) |
| InChIKey | IRTJSRKBDOCODU-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.02 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|