C29H38N6O6 — CID 90421647
tert-butyl 6-(4-aminophenyl)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-cyclopropylpyrazolo[3,4-d]pyrimidine-1-carboxylate (PubChem CID 90421647) has the molecular formula C29H38N6O6 and a molecular weight of 566.66 g/mol. Its IUPAC name is tert-butyl 6-(4-aminophenyl)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-cyclopropylpyrazolo[3,4-d]pyrimidine-1-carboxylate.
| Compound Name | tert-butyl 6-(4-aminophenyl)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-cyclopropylpyrazolo[3,4-d]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 90421647 |
| Molecular Formula | C29H38N6O6 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | tert-butyl 6-(4-aminophenyl)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-cyclopropylpyrazolo[3,4-d]pyrimidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1nn(C(=O)OC(C)(C)C)c2nc(-c3ccc(N)cc3)nc(C3CC3)c12 |
| InChI | InChI=1S/C29H38N6O6/c1-27(2,3)39-24(36)34(25(37)40-28(4,5)6)23-19-20(16-10-11-16)31-21(17-12-14-18(30)15-13-17)32-22(19)35(33-23)26(38)41-29(7,8)9/h12-16H,10-11,30H2,1-9H3 |
| InChIKey | JLXSZEIJAQWFCH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 151.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|