C21H27N4O16P3 — CID 90449204
[[3-[(2S)-2-amino-3-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-3-oxopropyl]phenoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90449204) has the molecular formula C21H27N4O16P3 and a molecular weight of 684.38 g/mol. Its IUPAC name is [[3-[(2S)-2-amino-3-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-3-oxopropyl]phenoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[3-[(2S)-2-amino-3-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-3-oxopropyl]phenoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90449204 |
| Molecular Formula | C21H27N4O16P3 |
| Molecular Weight | 684.38 g/mol |
| Exact Mass | 684.06 |
| IUPAC Name | [[3-[(2S)-2-amino-3-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynylamino]-3-oxopropyl]phenoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | N[C@@H](Cc1cccc(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)c1)C(=O)NCC#Cc1cc([N+](=O)[O-])n([C@H]2C[C@H](O)[C@@H](CO)O2)c1 |
| InChI | InChI=1S/C21H27N4O16P3/c22-16(8-13-3-1-5-15(7-13)39-43(34,35)41-44(36,37)40-42(31,32)33)21(28)23-6-2-4-14-9-19(25(29)30)24(11-14)20-10-17(27)18(12-26)38-20/h1,3,5,7,9,11,16-18,20,26-27H,6,8,10,12,22H2,(H,23,28)(H,34,35)(H,36,37)(H2,31,32,33)/t16-,17-,18+,20+/m0/s1 |
| InChIKey | PMXUJUZWLLXEIA-PNYFIKQUSA-N |
| XLogP | -0.22 |
| TPSA | 312.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|