C20H34N5O16P3 — CID 90449308
[[1-[[(2S)-2,6-diaminohexanoyl]amino]-5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90449308) has the molecular formula C20H34N5O16P3 and a molecular weight of 693.43 g/mol. Its IUPAC name is [[1-[[(2S)-2,6-diaminohexanoyl]amino]-5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[1-[[(2S)-2,6-diaminohexanoyl]amino]-5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90449308 |
| Molecular Formula | C20H34N5O16P3 |
| Molecular Weight | 693.43 g/mol |
| Exact Mass | 693.12 |
| IUPAC Name | [[1-[[(2S)-2,6-diaminohexanoyl]amino]-5-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]pent-4-ynoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCCCC[C@H](N)C(=O)NC(CCC#Cc1cc([N+](=O)[O-])n([C@H]2C[C@H](O)[C@@H](CO)O2)c1)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C20H34N5O16P3/c21-8-4-3-6-14(22)20(28)23-17(39-43(34,35)41-44(36,37)40-42(31,32)33)7-2-1-5-13-9-18(25(29)30)24(11-13)19-10-15(27)16(12-26)38-19/h9,11,14-17,19,26-27H,2-4,6-8,10,12,21-22H2,(H,23,28)(H,34,35)(H,36,37)(H2,31,32,33)/t14-,15-,16+,17?,19+/m0/s1 |
| InChIKey | MRROGVSMDRBCPO-ASCQJNAESA-N |
| XLogP | -0.59 |
| TPSA | 338.72 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.43 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|