C16H4Cl10O — CID 90476327
1,2,3,4,5-pentachloro-6-[1-[1-(2,3,4,5,6-pentachlorophenyl)ethenoxy]ethenyl]benzene (PubChem CID 90476327) has the molecular formula C16H4Cl10O and a molecular weight of 566.74 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-[1-[1-(2,3,4,5,6-pentachlorophenyl)ethenoxy]ethenyl]benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-[1-[1-(2,3,4,5,6-pentachlorophenyl)ethenoxy]ethenyl]benzene |
|---|---|
| PubChem CID | 90476327 |
| Molecular Formula | C16H4Cl10O |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 561.71 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-[1-[1-(2,3,4,5,6-pentachlorophenyl)ethenoxy]ethenyl]benzene |
| SMILES | C=C(OC(=C)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H4Cl10O/c1-3(5-7(17)11(21)15(25)12(22)8(5)18)27-4(2)6-9(19)13(23)16(26)14(24)10(6)20/h1-2H2 |
| InChIKey | DMIKMUAWMRNJKS-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|