C25H23N2OS+ — CID 9051564
[4-(phenylcarbamoyl)phenyl]methyl-[(R)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 9051564) has the molecular formula C25H23N2OS+ and a molecular weight of 399.54 g/mol. Its IUPAC name is [4-(phenylcarbamoyl)phenyl]methyl-[(R)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [4-(phenylcarbamoyl)phenyl]methyl-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9051564 |
| Molecular Formula | C25H23N2OS+ |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [4-(phenylcarbamoyl)phenyl]methyl-[(R)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | O=C(Nc1ccccc1)c1ccc(C[NH2+][C@H](c2ccccc2)c2cccs2)cc1 |
| InChI | InChI=1S/C25H22N2OS/c28-25(27-22-10-5-2-6-11-22)21-15-13-19(14-16-21)18-26-24(23-12-7-17-29-23)20-8-3-1-4-9-20/h1-17,24,26H,18H2,(H,27,28)/p+1/t24-/m1/s1 |
| InChIKey | WYKAMRULKCUMKC-XMMPIXPASA-O |
| XLogP | 4.85 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |