C18H29N3O3S — CID 9054017
1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1-methyl-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 9054017) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1-methyl-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1-methyl-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 9054017 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1-methyl-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1cc(C)c(CN(C)C(=S)NCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C18H29N3O3S/c1-14-11-16(22-3)17(23-4)12-15(14)13-20(2)18(25)19-5-6-21-7-9-24-10-8-21/h11-12H,5-10,13H2,1-4H3,(H,19,25) |
| InChIKey | RSEJYEMSCGBFCJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|