C18H19F2N3 — CID 9058427
N-[(1-benzylpiperidin-4-ylidene)amino]-2,4-difluoroaniline (PubChem CID 9058427) has the molecular formula C18H19F2N3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-ylidene)amino]-2,4-difluoroaniline.
| Compound Name | N-[(1-benzylpiperidin-4-ylidene)amino]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 9058427 |
| Molecular Formula | C18H19F2N3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[(1-benzylpiperidin-4-ylidene)amino]-2,4-difluoroaniline |
| SMILES | Fc1ccc(NN=C2CCN(Cc3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C18H19F2N3/c19-15-6-7-18(17(20)12-15)22-21-16-8-10-23(11-9-16)13-14-4-2-1-3-5-14/h1-7,12,22H,8-11,13H2 |
| InChIKey | JSZQXVRCNRAIAV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|