C22H27N5O4 — CID 90588973
3,4,5-triethoxy-N-[2-(2-pyrimidin-2-ylimidazol-1-yl)ethyl]benzamide (PubChem CID 90588973) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[2-(2-pyrimidin-2-ylimidazol-1-yl)ethyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[2-(2-pyrimidin-2-ylimidazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90588973 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 3,4,5-triethoxy-N-[2-(2-pyrimidin-2-ylimidazol-1-yl)ethyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCCn2ccnc2-c2ncccn2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H27N5O4/c1-4-29-17-14-16(15-18(30-5-2)19(17)31-6-3)22(28)26-11-13-27-12-10-25-21(27)20-23-8-7-9-24-20/h7-10,12,14-15H,4-6,11,13H2,1-3H3,(H,26,28) |
| InChIKey | FZBKJHLKFFGWQP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |