C17H13N3O3S — CID 90624719
1-(1,2-benzoxazol-3-yl)-N-quinolin-5-ylmethanesulfonamide (PubChem CID 90624719) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)-N-quinolin-5-ylmethanesulfonamide.
| Compound Name | 1-(1,2-benzoxazol-3-yl)-N-quinolin-5-ylmethanesulfonamide |
|---|---|
| PubChem CID | 90624719 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)-N-quinolin-5-ylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1noc2ccccc12)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C17H13N3O3S/c21-24(22,11-16-13-5-1-2-9-17(13)23-19-16)20-15-8-3-7-14-12(15)6-4-10-18-14/h1-10,20H,11H2 |
| InChIKey | YCGKKCXMIAXLAM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |