C14H20ClN3 — CID 90672422
3-methyl-8-(1,4,5,6-tetrahydropyrimidin-2-yl)-5,6,7,8-tetrahydroquinoline;hydrochloride (PubChem CID 90672422) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 3-methyl-8-(1,4,5,6-tetrahydropyrimidin-2-yl)-5,6,7,8-tetrahydroquinoline;hydrochloride.
| Compound Name | 3-methyl-8-(1,4,5,6-tetrahydropyrimidin-2-yl)-5,6,7,8-tetrahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 90672422 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-methyl-8-(1,4,5,6-tetrahydropyrimidin-2-yl)-5,6,7,8-tetrahydroquinoline;hydrochloride |
| SMILES | Cc1cnc2c(c1)CCCC2C1=NCCCN1.Cl |
| InChI | InChI=1S/C14H19N3.ClH/c1-10-8-11-4-2-5-12(13(11)17-9-10)14-15-6-3-7-16-14;/h8-9,12H,2-7H2,1H3,(H,15,16);1H |
| InChIKey | GXCFKAWMRIPXIO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |